C23H25BrN2O5S2 — CID 98191783
N-[(3aR,6aS)-3-(4-bromo-2,6-dimethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 98191783) has the molecular formula C23H25BrN2O5S2 and a molecular weight of 553.50 g/mol. Its IUPAC name is N-[(3aR,6aS)-3-(4-bromo-2,6-dimethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[(3aR,6aS)-3-(4-bromo-2,6-dimethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 98191783 |
| Molecular Formula | C23H25BrN2O5S2 |
| Molecular Weight | 553.50 g/mol |
| Exact Mass | 552.04 |
| IUPAC Name | N-[(3aR,6aS)-3-(4-bromo-2,6-dimethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)/N=C2\S[C@@H]3CS(=O)(=O)C[C@H]3N2c2c(C)cc(Br)cc2C)cc1OC |
| InChI | InChI=1S/C23H25BrN2O5S2/c1-13-7-16(24)8-14(2)22(13)26-17-11-33(28,29)12-20(17)32-23(26)25-21(27)10-15-5-6-18(30-3)19(9-15)31-4/h5-9,17,20H,10-12H2,1-4H3/b25-23-/t17-,20-/m1/s1 |
| InChIKey | DIIZREWDGNRBOY-KXXBSLBASA-N |
| XLogP | 3.93 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|