C14H16BrFN2O2S — CID 98194871
1-[(3R)-1-(5-bromo-2-fluorophenyl)sulfonylpyrrolidin-3-yl]-2,5-dihydropyrrole (PubChem CID 98194871) has the molecular formula C14H16BrFN2O2S and a molecular weight of 375.26 g/mol. Its IUPAC name is 1-[(3R)-1-(5-bromo-2-fluorophenyl)sulfonylpyrrolidin-3-yl]-2,5-dihydropyrrole.
| Compound Name | 1-[(3R)-1-(5-bromo-2-fluorophenyl)sulfonylpyrrolidin-3-yl]-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 98194871 |
| Molecular Formula | C14H16BrFN2O2S |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | 1-[(3R)-1-(5-bromo-2-fluorophenyl)sulfonylpyrrolidin-3-yl]-2,5-dihydropyrrole |
| SMILES | O=S(=O)(c1cc(Br)ccc1F)N1CC[C@@H](N2CC=CC2)C1 |
| InChI | InChI=1S/C14H16BrFN2O2S/c15-11-3-4-13(16)14(9-11)21(19,20)18-8-5-12(10-18)17-6-1-2-7-17/h1-4,9,12H,5-8,10H2/t12-/m1/s1 |
| InChIKey | LMDJJRHMUSWDPF-GFCCVEGCSA-N |
| XLogP | 2.22 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|