C15H23NOS — CID 98201300
(1R,2R,4S)-N-[(1R,3R)-3-ethylsulfanylcyclopentyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 98201300) has the molecular formula C15H23NOS and a molecular weight of 265.42 g/mol. Its IUPAC name is (1R,2R,4S)-N-[(1R,3R)-3-ethylsulfanylcyclopentyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2R,4S)-N-[(1R,3R)-3-ethylsulfanylcyclopentyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 98201300 |
| Molecular Formula | C15H23NOS |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (1R,2R,4S)-N-[(1R,3R)-3-ethylsulfanylcyclopentyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CCS[C@@H]1CC[C@@H](NC(=O)[C@@H]2C[C@H]3C=C[C@H]2C3)C1 |
| InChI | InChI=1S/C15H23NOS/c1-2-18-13-6-5-12(9-13)16-15(17)14-8-10-3-4-11(14)7-10/h3-4,10-14H,2,5-9H2,1H3,(H,16,17)/t10-,11-,12+,13+,14+/m0/s1 |
| InChIKey | IDKJJYAJCQBDCA-ODXJTPSBSA-N |
| XLogP | 2.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|