C20H22N2O2S2 — CID 98204178
(1R,9S,13S)-6-methoxy-9,13-dimethyl-10-(3-methylsulfanylphenyl)-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11-thione (PubChem CID 98204178) has the molecular formula C20H22N2O2S2 and a molecular weight of 386.54 g/mol. Its IUPAC name is (1R,9S,13S)-6-methoxy-9,13-dimethyl-10-(3-methylsulfanylphenyl)-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11-thione.
| Compound Name | (1R,9S,13S)-6-methoxy-9,13-dimethyl-10-(3-methylsulfanylphenyl)-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11-thione |
|---|---|
| PubChem CID | 98204178 |
| Molecular Formula | C20H22N2O2S2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | (1R,9S,13S)-6-methoxy-9,13-dimethyl-10-(3-methylsulfanylphenyl)-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11-thione |
| SMILES | COc1cccc2c1O[C@@]1(C)[C@@H](C)[C@H]2NC(=S)N1c1cccc(SC)c1 |
| InChI | InChI=1S/C20H22N2O2S2/c1-12-17-15-9-6-10-16(23-3)18(15)24-20(12,2)22(19(25)21-17)13-7-5-8-14(11-13)26-4/h5-12,17H,1-4H3,(H,21,25)/t12-,17+,20-/m0/s1 |
| InChIKey | POGWQUQWPQMAKK-TUIFFPIZSA-N |
| XLogP | 4.60 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|