C19H17ClN4O2 — CID 98208426
(3aS,6aR)-5-(2-chlorophenyl)-3-[(4-ethylphenyl)methyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione (PubChem CID 98208426) has the molecular formula C19H17ClN4O2 and a molecular weight of 368.82 g/mol. Its IUPAC name is (3aS,6aR)-5-(2-chlorophenyl)-3-[(4-ethylphenyl)methyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione.
| Compound Name | (3aS,6aR)-5-(2-chlorophenyl)-3-[(4-ethylphenyl)methyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
|---|---|
| PubChem CID | 98208426 |
| Molecular Formula | C19H17ClN4O2 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (3aS,6aR)-5-(2-chlorophenyl)-3-[(4-ethylphenyl)methyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
| SMILES | CCc1ccc(CN2N=N[C@H]3C(=O)N(c4ccccc4Cl)C(=O)[C@H]32)cc1 |
| InChI | InChI=1S/C19H17ClN4O2/c1-2-12-7-9-13(10-8-12)11-23-17-16(21-22-23)18(25)24(19(17)26)15-6-4-3-5-14(15)20/h3-10,16-17H,2,11H2,1H3/t16-,17+/m1/s1 |
| InChIKey | NLNJMUKTCZLHSO-SJORKVTESA-N |
| XLogP | 3.40 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|