C16H18N2O5 — CID 98219437
(1R,2S,3R,4R)-3-[[(2-methylfuran-3-carbonyl)amino]carbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid (PubChem CID 98219437) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is (1R,2S,3R,4R)-3-[[(2-methylfuran-3-carbonyl)amino]carbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid.
| Compound Name | (1R,2S,3R,4R)-3-[[(2-methylfuran-3-carbonyl)amino]carbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 98219437 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | (1R,2S,3R,4R)-3-[[(2-methylfuran-3-carbonyl)amino]carbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
| SMILES | Cc1occc1C(=O)NNC(=O)[C@H]1[C@@H](C(=O)O)[C@H]2C=C[C@H]1CC2 |
| InChI | InChI=1S/C16H18N2O5/c1-8-11(6-7-23-8)14(19)17-18-15(20)12-9-2-4-10(5-3-9)13(12)16(21)22/h2,4,6-7,9-10,12-13H,3,5H2,1H3,(H,17,19)(H,18,20)(H,21,22)/t9-,10-,12+,13-/m0/s1 |
| InChIKey | ZSHCLNMZGHDSTQ-DJIHRAIXSA-N |
| XLogP | 1.26 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|