C14H17N2O5- — CID 2384128
trans-(1S,2S)-2-[[(2-methylfuran-3-carbonyl)amino]carbamoyl]cyclohexane-1-carboxylate (PubChem CID 2384128) has the molecular formula C14H17N2O5- and a molecular weight of 293.30 g/mol. Its IUPAC name is trans-(1S,2S)-2-[[(2-methylfuran-3-carbonyl)amino]carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | trans-(1S,2S)-2-[[(2-methylfuran-3-carbonyl)amino]carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 2384128 |
| Molecular Formula | C14H17N2O5- |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | trans-(1S,2S)-2-[[(2-methylfuran-3-carbonyl)amino]carbamoyl]cyclohexane-1-carboxylate |
| SMILES | Cc1occc1C(=O)NNC(=O)[C@H]1CCCC[C@@H]1C(=O)[O-] |
| InChI | InChI=1S/C14H18N2O5/c1-8-9(6-7-21-8)12(17)15-16-13(18)10-4-2-3-5-11(10)14(19)20/h6-7,10-11H,2-5H2,1H3,(H,15,17)(H,16,18)(H,19,20)/p-1/t10-,11-/m0/s1 |
| InChIKey | SCBVLKOAIFNQJQ-QWRGUYRKSA-M |
| XLogP | -0.09 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|