C16H19N2O4- — CID 7311337
trans-(1R,2R)-2-[[(4-methylbenzoyl)amino]carbamoyl]cyclohexane-1-carboxylate (PubChem CID 7311337) has the molecular formula C16H19N2O4- and a molecular weight of 303.34 g/mol. Its IUPAC name is trans-(1R,2R)-2-[[(4-methylbenzoyl)amino]carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | trans-(1R,2R)-2-[[(4-methylbenzoyl)amino]carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 7311337 |
| Molecular Formula | C16H19N2O4- |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | trans-(1R,2R)-2-[[(4-methylbenzoyl)amino]carbamoyl]cyclohexane-1-carboxylate |
| SMILES | Cc1ccc(C(=O)NNC(=O)[C@@H]2CCCC[C@H]2C(=O)[O-])cc1 |
| InChI | InChI=1S/C16H20N2O4/c1-10-6-8-11(9-7-10)14(19)17-18-15(20)12-4-2-3-5-13(12)16(21)22/h6-9,12-13H,2-5H2,1H3,(H,17,19)(H,18,20)(H,21,22)/p-1/t12-,13-/m1/s1 |
| InChIKey | WLDRPCLOEQRWOQ-CHWSQXEVSA-M |
| XLogP | 0.31 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|