C18H20N4O4 — CID 98222387
4-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(furan-2-ylmethyl)-1-methylpyrazole-5-carboxamide (PubChem CID 98222387) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is 4-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(furan-2-ylmethyl)-1-methylpyrazole-5-carboxamide.
| Compound Name | 4-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(furan-2-ylmethyl)-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 98222387 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 4-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(furan-2-ylmethyl)-1-methylpyrazole-5-carboxamide |
| SMILES | Cn1ncc(N2C(=O)[C@H]3CCCC[C@@H]3C2=O)c1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C18H20N4O4/c1-21-15(16(23)19-9-11-5-4-8-26-11)14(10-20-21)22-17(24)12-6-2-3-7-13(12)18(22)25/h4-5,8,10,12-13H,2-3,6-7,9H2,1H3,(H,19,23)/t12-,13-/m0/s1 |
| InChIKey | LCQUJGWHPFNPDI-STQMWFEESA-N |
| XLogP | 1.62 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|