C18H15F3N4O2 — CID 4862771
N-(furan-2-ylmethyl)-1-methyl-4-[[2-(trifluoromethyl)phenyl]methylideneamino]pyrazole-5-carboxamide (PubChem CID 4862771) has the molecular formula C18H15F3N4O2 and a molecular weight of 376.34 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1-methyl-4-[[2-(trifluoromethyl)phenyl]methylideneamino]pyrazole-5-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-1-methyl-4-[[2-(trifluoromethyl)phenyl]methylideneamino]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4862771 |
| Molecular Formula | C18H15F3N4O2 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | N-(furan-2-ylmethyl)-1-methyl-4-[[2-(trifluoromethyl)phenyl]methylideneamino]pyrazole-5-carboxamide |
| SMILES | Cn1ncc(/N=C/c2ccccc2C(F)(F)F)c1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C18H15F3N4O2/c1-25-16(17(26)23-10-13-6-4-8-27-13)15(11-24-25)22-9-12-5-2-3-7-14(12)18(19,20)21/h2-9,11H,10H2,1H3,(H,23,26)/b22-9+ |
| InChIKey | NTKIHEIMQJQNTE-LSFURLLWSA-N |
| XLogP | 3.71 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|