C21H25N3O4 — CID 98226210
N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-3-(6,7-dimethoxy-4-oxoquinazolin-3-yl)propanamide (PubChem CID 98226210) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-3-(6,7-dimethoxy-4-oxoquinazolin-3-yl)propanamide.
| Compound Name | N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-3-(6,7-dimethoxy-4-oxoquinazolin-3-yl)propanamide |
|---|---|
| PubChem CID | 98226210 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-3-(6,7-dimethoxy-4-oxoquinazolin-3-yl)propanamide |
| SMILES | COc1cc2ncn(CCC(=O)NC[C@@H]3C[C@H]4C=C[C@H]3C4)c(=O)c2cc1OC |
| InChI | InChI=1S/C21H25N3O4/c1-27-18-9-16-17(10-19(18)28-2)23-12-24(21(16)26)6-5-20(25)22-11-15-8-13-3-4-14(15)7-13/h3-4,9-10,12-15H,5-8,11H2,1-2H3,(H,22,25)/t13-,14-,15-/m0/s1 |
| InChIKey | WMJKVAKSPLZBEN-KKUMJFAQSA-N |
| XLogP | 2.13 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|