C18H19N3O2 — CID 98232982
3-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]-4-(pyridin-4-ylmethylamino)cyclobut-3-ene-1,2-dione (PubChem CID 98232982) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]-4-(pyridin-4-ylmethylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]-4-(pyridin-4-ylmethylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 98232982 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 3-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]-4-(pyridin-4-ylmethylamino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCc2ccncc2)c(NC[C@H]2C[C@H]3C=C[C@H]2C3)c1=O |
| InChI | InChI=1S/C18H19N3O2/c22-17-15(20-9-11-3-5-19-6-4-11)16(18(17)23)21-10-14-8-12-1-2-13(14)7-12/h1-6,12-14,20-21H,7-10H2/t12-,13-,14+/m0/s1 |
| InChIKey | ZTGFOBMIDLIUFS-MELADBBJSA-N |
| XLogP | 1.91 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|