C20H24Cl2N2O4 — CID 98234498
2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(3,4-dichlorophenyl)methyl]-N-(3-hydroxypropyl)acetamide (PubChem CID 98234498) has the molecular formula C20H24Cl2N2O4 and a molecular weight of 427.33 g/mol. Its IUPAC name is 2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(3,4-dichlorophenyl)methyl]-N-(3-hydroxypropyl)acetamide.
| Compound Name | 2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(3,4-dichlorophenyl)methyl]-N-(3-hydroxypropyl)acetamide |
|---|---|
| PubChem CID | 98234498 |
| Molecular Formula | C20H24Cl2N2O4 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(3,4-dichlorophenyl)methyl]-N-(3-hydroxypropyl)acetamide |
| SMILES | O=C(CN1C(=O)[C@H]2CCCC[C@H]2C1=O)N(CCCO)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H24Cl2N2O4/c21-16-7-6-13(10-17(16)22)11-23(8-3-9-25)18(26)12-24-19(27)14-4-1-2-5-15(14)20(24)28/h6-7,10,14-15,25H,1-5,8-9,11-12H2/t14-,15+ |
| InChIKey | NBGBHYQDHLNULT-GASCZTMLSA-N |
| XLogP | 2.88 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|