C17H21Cl2N3O3 — CID 55978200
N-[(3,4-dichlorophenyl)methyl]-N-ethyl-2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetamide (PubChem CID 55978200) has the molecular formula C17H21Cl2N3O3 and a molecular weight of 386.28 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-N-ethyl-2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-N-ethyl-2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 55978200 |
| Molecular Formula | C17H21Cl2N3O3 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-N-ethyl-2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetamide |
| SMILES | CCN(Cc1ccc(Cl)c(Cl)c1)C(=O)CN1CCN(CC)C(=O)C1=O |
| InChI | InChI=1S/C17H21Cl2N3O3/c1-3-20-7-8-22(17(25)16(20)24)11-15(23)21(4-2)10-12-5-6-13(18)14(19)9-12/h5-6,9H,3-4,7-8,10-11H2,1-2H3 |
| InChIKey | UELGZMMBRAQPMW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|