C21H25N5O2 — CID 98241753
2-methyl-N-[[4-[(3R)-3-methylpiperidin-1-yl]phenyl]methyl]-7-oxo-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 98241753) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-methyl-N-[[4-[(3R)-3-methylpiperidin-1-yl]phenyl]methyl]-7-oxo-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-methyl-N-[[4-[(3R)-3-methylpiperidin-1-yl]phenyl]methyl]-7-oxo-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 98241753 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 2-methyl-N-[[4-[(3R)-3-methylpiperidin-1-yl]phenyl]methyl]-7-oxo-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | Cc1cc2ncc(C(=O)NCc3ccc(N4CCC[C@@H](C)C4)cc3)c(=O)n2[nH]1 |
| InChI | InChI=1S/C21H25N5O2/c1-14-4-3-9-25(13-14)17-7-5-16(6-8-17)11-23-20(27)18-12-22-19-10-15(2)24-26(19)21(18)28/h5-8,10,12,14,24H,3-4,9,11,13H2,1-2H3,(H,23,27)/t14-/m1/s1 |
| InChIKey | UZKJQINFCOUGAJ-CQSZACIVSA-N |
| XLogP | 2.50 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|