C22H25N3O2 — CID 99933479
2-methyl-N-[[4-[(3R)-3-methylpiperidin-1-yl]phenyl]methyl]-1,3-benzoxazole-6-carboxamide (PubChem CID 99933479) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-methyl-N-[[4-[(3R)-3-methylpiperidin-1-yl]phenyl]methyl]-1,3-benzoxazole-6-carboxamide.
| Compound Name | 2-methyl-N-[[4-[(3R)-3-methylpiperidin-1-yl]phenyl]methyl]-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 99933479 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 2-methyl-N-[[4-[(3R)-3-methylpiperidin-1-yl]phenyl]methyl]-1,3-benzoxazole-6-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)NCc3ccc(N4CCC[C@@H](C)C4)cc3)cc2o1 |
| InChI | InChI=1S/C22H25N3O2/c1-15-4-3-11-25(14-15)19-8-5-17(6-9-19)13-23-22(26)18-7-10-20-21(12-18)27-16(2)24-20/h5-10,12,15H,3-4,11,13-14H2,1-2H3,(H,23,26)/t15-/m1/s1 |
| InChIKey | HLVAVFKPDYXSJZ-OAHLLOKOSA-N |
| XLogP | 4.30 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|