C23H33N3O2 — CID 98259935
1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-3-(2-methyl-4-morpholin-4-ylphenyl)-1-propan-2-ylurea (PubChem CID 98259935) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-3-(2-methyl-4-morpholin-4-ylphenyl)-1-propan-2-ylurea.
| Compound Name | 1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-3-(2-methyl-4-morpholin-4-ylphenyl)-1-propan-2-ylurea |
|---|---|
| PubChem CID | 98259935 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-3-(2-methyl-4-morpholin-4-ylphenyl)-1-propan-2-ylurea |
| SMILES | Cc1cc(N2CCOCC2)ccc1NC(=O)N(C[C@H]1C[C@H]2C=C[C@H]1C2)C(C)C |
| InChI | InChI=1S/C23H33N3O2/c1-16(2)26(15-20-14-18-4-5-19(20)13-18)23(27)24-22-7-6-21(12-17(22)3)25-8-10-28-11-9-25/h4-7,12,16,18-20H,8-11,13-15H2,1-3H3,(H,24,27)/t18-,19-,20+/m0/s1 |
| InChIKey | NOIGTULNGUCVMD-SLFFLAALSA-N |
| XLogP | 4.29 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|