C15H12N2O5 — CID 98259989
N-[(3aR,4R,7R,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-3-hydroxybenzamide (PubChem CID 98259989) has the molecular formula C15H12N2O5 and a molecular weight of 300.27 g/mol. Its IUPAC name is N-[(3aR,4R,7R,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-3-hydroxybenzamide.
| Compound Name | N-[(3aR,4R,7R,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-3-hydroxybenzamide |
|---|---|
| PubChem CID | 98259989 |
| Molecular Formula | C15H12N2O5 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | N-[(3aR,4R,7R,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-3-hydroxybenzamide |
| SMILES | O=C(NN1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@H]2O1)c1cccc(O)c1 |
| InChI | InChI=1S/C15H12N2O5/c18-8-3-1-2-7(6-8)13(19)16-17-14(20)11-9-4-5-10(22-9)12(11)15(17)21/h1-6,9-12,18H,(H,16,19)/t9-,10-,11-,12+/m1/s1 |
| InChIKey | UBBPRYCMHMVSJU-KKOKHZNYSA-N |
| XLogP | -0.02 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|