C18H23N3O5 — CID 98266301
[2-[[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]amino]-2-oxoethyl] 2-amino-4-nitrobenzoate (PubChem CID 98266301) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is [2-[[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]amino]-2-oxoethyl] 2-amino-4-nitrobenzoate.
| Compound Name | [2-[[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]amino]-2-oxoethyl] 2-amino-4-nitrobenzoate |
|---|---|
| PubChem CID | 98266301 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | [2-[[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]amino]-2-oxoethyl] 2-amino-4-nitrobenzoate |
| SMILES | C[C@H](NC(=O)COC(=O)c1ccc([N+](=O)[O-])cc1N)[C@@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C18H23N3O5/c1-10(15-7-11-2-3-12(15)6-11)20-17(22)9-26-18(23)14-5-4-13(21(24)25)8-16(14)19/h4-5,8,10-12,15H,2-3,6-7,9,19H2,1H3,(H,20,22)/t10-,11+,12+,15-/m0/s1 |
| InChIKey | MGRXGSBQOHGZNN-YFCNSXCBSA-N |
| XLogP | 2.27 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|