C18H13ClN2O3S — CID 982681
methyl N-[5-(4-chlorobenzoyl)-4-phenyl-1,3-thiazol-2-yl]carbamate (PubChem CID 982681) has the molecular formula C18H13ClN2O3S and a molecular weight of 372.83 g/mol. Its IUPAC name is methyl N-[5-(4-chlorobenzoyl)-4-phenyl-1,3-thiazol-2-yl]carbamate.
| Compound Name | methyl N-[5-(4-chlorobenzoyl)-4-phenyl-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 982681 |
| Molecular Formula | C18H13ClN2O3S |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | methyl N-[5-(4-chlorobenzoyl)-4-phenyl-1,3-thiazol-2-yl]carbamate |
| SMILES | COC(=O)Nc1nc(-c2ccccc2)c(C(=O)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C18H13ClN2O3S/c1-24-18(23)21-17-20-14(11-5-3-2-4-6-11)16(25-17)15(22)12-7-9-13(19)10-8-12/h2-10H,1H3,(H,20,21,23) |
| InChIKey | PJFKSQIMKLQERC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |