C21H24ClNO2S — CID 98300183
(5R,7R)-3-chloro-N-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)adamantane-1-carboxamide (PubChem CID 98300183) has the molecular formula C21H24ClNO2S and a molecular weight of 389.95 g/mol. Its IUPAC name is (5R,7R)-3-chloro-N-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)adamantane-1-carboxamide.
| Compound Name | (5R,7R)-3-chloro-N-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98300183 |
| Molecular Formula | C21H24ClNO2S |
| Molecular Weight | 389.95 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | (5R,7R)-3-chloro-N-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)adamantane-1-carboxamide |
| SMILES | O=C(N(Cc1ccco1)Cc1cccs1)C12C[C@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C21H24ClNO2S/c22-21-10-15-7-16(11-21)9-20(8-15,14-21)19(24)23(12-17-3-1-5-25-17)13-18-4-2-6-26-18/h1-6,15-16H,7-14H2/t15-,16-,20?,21?/m1/s1 |
| InChIKey | AOKQBPHIDSLJFA-AJHHTPGJSA-N |
| XLogP | 5.45 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.95 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|