C23H22N4OS — CID 98301237
(5R,5aR)-3-methyl-1-phenyl-5-(thiophene-2-carbonyl)-4,5a,6,7,8,9-hexahydropyrazolo[4,5-c]quinolizine-5-carbonitrile (PubChem CID 98301237) has the molecular formula C23H22N4OS and a molecular weight of 402.52 g/mol. Its IUPAC name is (5R,5aR)-3-methyl-1-phenyl-5-(thiophene-2-carbonyl)-4,5a,6,7,8,9-hexahydropyrazolo[4,5-c]quinolizine-5-carbonitrile.
| Compound Name | (5R,5aR)-3-methyl-1-phenyl-5-(thiophene-2-carbonyl)-4,5a,6,7,8,9-hexahydropyrazolo[4,5-c]quinolizine-5-carbonitrile |
|---|---|
| PubChem CID | 98301237 |
| Molecular Formula | C23H22N4OS |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (5R,5aR)-3-methyl-1-phenyl-5-(thiophene-2-carbonyl)-4,5a,6,7,8,9-hexahydropyrazolo[4,5-c]quinolizine-5-carbonitrile |
| SMILES | Cc1nn(-c2ccccc2)c2c1C[C@@](C#N)(C(=O)c1cccs1)[C@H]1CCCCN21 |
| InChI | InChI=1S/C23H22N4OS/c1-16-18-14-23(15-24,21(28)19-10-7-13-29-19)20-11-5-6-12-26(20)22(18)27(25-16)17-8-3-2-4-9-17/h2-4,7-10,13,20H,5-6,11-12,14H2,1H3/t20-,23+/m1/s1 |
| InChIKey | IDMGGRDKWDCZOA-OFNKIYASSA-N |
| XLogP | 4.55 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |