C24H21N3O2 — CID 7999483
(5aS)-3-methyl-1-phenylspiro[5a,6,7,8-tetrahydro-4H-pyrazolo[5,4-e]indolizine-5,2'-indene]-1',3'-dione (PubChem CID 7999483) has the molecular formula C24H21N3O2 and a molecular weight of 383.45 g/mol. Its IUPAC name is (5aS)-3-methyl-1-phenylspiro[5a,6,7,8-tetrahydro-4H-pyrazolo[5,4-e]indolizine-5,2'-indene]-1',3'-dione.
| Compound Name | (5aS)-3-methyl-1-phenylspiro[5a,6,7,8-tetrahydro-4H-pyrazolo[5,4-e]indolizine-5,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 7999483 |
| Molecular Formula | C24H21N3O2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | (5aS)-3-methyl-1-phenylspiro[5a,6,7,8-tetrahydro-4H-pyrazolo[5,4-e]indolizine-5,2'-indene]-1',3'-dione |
| SMILES | Cc1nn(-c2ccccc2)c2c1CC1(C(=O)c3ccccc3C1=O)[C@@H]1CCCN21 |
| InChI | InChI=1S/C24H21N3O2/c1-15-19-14-24(21(28)17-10-5-6-11-18(17)22(24)29)20-12-7-13-26(20)23(19)27(25-15)16-8-3-2-4-9-16/h2-6,8-11,20H,7,12-14H2,1H3/t20-/m0/s1 |
| InChIKey | CRPRWBVHNBNMBO-FQEVSTJZSA-N |
| XLogP | 3.77 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|