C24H20ClN3O — CID 8834702
(4aS,5S)-5-(4-chlorobenzoyl)-1,2,3,4,4a,6-hexahydroquinolino[3,2-c]quinolizine-5-carbonitrile (PubChem CID 8834702) has the molecular formula C24H20ClN3O and a molecular weight of 401.90 g/mol. Its IUPAC name is (4aS,5S)-5-(4-chlorobenzoyl)-1,2,3,4,4a,6-hexahydroquinolino[3,2-c]quinolizine-5-carbonitrile.
| Compound Name | (4aS,5S)-5-(4-chlorobenzoyl)-1,2,3,4,4a,6-hexahydroquinolino[3,2-c]quinolizine-5-carbonitrile |
|---|---|
| PubChem CID | 8834702 |
| Molecular Formula | C24H20ClN3O |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | (4aS,5S)-5-(4-chlorobenzoyl)-1,2,3,4,4a,6-hexahydroquinolino[3,2-c]quinolizine-5-carbonitrile |
| SMILES | N#C[C@]1(C(=O)c2ccc(Cl)cc2)Cc2cc3ccccc3nc2N2CCCC[C@H]21 |
| InChI | InChI=1S/C24H20ClN3O/c25-19-10-8-16(9-11-19)22(29)24(15-26)14-18-13-17-5-1-2-6-20(17)27-23(18)28-12-4-3-7-21(24)28/h1-2,5-6,8-11,13,21H,3-4,7,12,14H2/t21-,24+/m0/s1 |
| InChIKey | BCCSYYNPYNJQAW-XUZZJYLKSA-N |
| XLogP | 5.20 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |