C21H22N4O3 — CID 7554991
(4aR,5S)-1',9-dimethylspiro[1,2,3,4,4a,6-hexahydroquinolino[3,2-c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione (PubChem CID 7554991) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is (4aR,5S)-1',9-dimethylspiro[1,2,3,4,4a,6-hexahydroquinolino[3,2-c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione.
| Compound Name | (4aR,5S)-1',9-dimethylspiro[1,2,3,4,4a,6-hexahydroquinolino[3,2-c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione |
|---|---|
| PubChem CID | 7554991 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (4aR,5S)-1',9-dimethylspiro[1,2,3,4,4a,6-hexahydroquinolino[3,2-c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione |
| SMILES | Cc1ccc2nc3c(cc2c1)C[C@@]1(C(=O)NC(=O)N(C)C1=O)[C@H]1CCCCN31 |
| InChI | InChI=1S/C21H22N4O3/c1-12-6-7-15-13(9-12)10-14-11-21(18(26)23-20(28)24(2)19(21)27)16-5-3-4-8-25(16)17(14)22-15/h6-7,9-10,16H,3-5,8,11H2,1-2H3,(H,23,26,28)/t16-,21+/m1/s1 |
| InChIKey | LKXJXFFBSFUVQP-IERDGZPVSA-N |
| XLogP | 2.15 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|