C26H30N4O3 — CID 99885029
(4aR,5R)-1'-cyclohexyl-9-methylspiro[1,2,3,4,4a,6-hexahydroquinolino[3,2-c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione (PubChem CID 99885029) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is (4aR,5R)-1'-cyclohexyl-9-methylspiro[1,2,3,4,4a,6-hexahydroquinolino[3,2-c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione.
| Compound Name | (4aR,5R)-1'-cyclohexyl-9-methylspiro[1,2,3,4,4a,6-hexahydroquinolino[3,2-c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione |
|---|---|
| PubChem CID | 99885029 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | (4aR,5R)-1'-cyclohexyl-9-methylspiro[1,2,3,4,4a,6-hexahydroquinolino[3,2-c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione |
| SMILES | Cc1ccc2nc3c(cc2c1)C[C@]1(C(=O)NC(=O)N(C2CCCCC2)C1=O)[C@H]1CCCCN31 |
| InChI | InChI=1S/C26H30N4O3/c1-16-10-11-20-17(13-16)14-18-15-26(21-9-5-6-12-29(21)22(18)27-20)23(31)28-25(33)30(24(26)32)19-7-3-2-4-8-19/h10-11,13-14,19,21H,2-9,12,15H2,1H3,(H,28,31,33)/t21-,26-/m1/s1 |
| InChIKey | HNRZMLRLNGETIV-QFQXNSOFSA-N |
| XLogP | 3.86 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|