C27H25ClN4O3 — CID 29035096
(4aR,5S)-1'-[(2-chlorophenyl)methyl]-9-methylspiro[1,2,3,4,4a,6-hexahydroquinolino[3,2-c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione (PubChem CID 29035096) has the molecular formula C27H25ClN4O3 and a molecular weight of 488.98 g/mol. Its IUPAC name is (4aR,5S)-1'-[(2-chlorophenyl)methyl]-9-methylspiro[1,2,3,4,4a,6-hexahydroquinolino[3,2-c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione.
| Compound Name | (4aR,5S)-1'-[(2-chlorophenyl)methyl]-9-methylspiro[1,2,3,4,4a,6-hexahydroquinolino[3,2-c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione |
|---|---|
| PubChem CID | 29035096 |
| Molecular Formula | C27H25ClN4O3 |
| Molecular Weight | 488.98 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | (4aR,5S)-1'-[(2-chlorophenyl)methyl]-9-methylspiro[1,2,3,4,4a,6-hexahydroquinolino[3,2-c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione |
| SMILES | Cc1ccc2nc3c(cc2c1)C[C@@]1(C(=O)NC(=O)N(Cc2ccccc2Cl)C1=O)[C@H]1CCCCN31 |
| InChI | InChI=1S/C27H25ClN4O3/c1-16-9-10-21-18(12-16)13-19-14-27(22-8-4-5-11-31(22)23(19)29-21)24(33)30-26(35)32(25(27)34)15-17-6-2-3-7-20(17)28/h2-3,6-7,9-10,12-13,22H,4-5,8,11,14-15H2,1H3,(H,30,33,35)/t22-,27+/m1/s1 |
| InChIKey | UISUEXUTUQMPTB-AMGIVPHBSA-N |
| XLogP | 4.38 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.98 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|