C24H22ClN5O4 — CID 92527759
(5S,6'R)-1-[(2-chlorophenyl)methyl]-7'-ethyl-6'-methylspiro[1,3-diazinane-5,5'-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene]-2,2',4,6-tetrone (PubChem CID 92527759) has the molecular formula C24H22ClN5O4 and a molecular weight of 479.92 g/mol. Its IUPAC name is (5S,6'R)-1-[(2-chlorophenyl)methyl]-7'-ethyl-6'-methylspiro[1,3-diazinane-5,5'-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene]-2,2',4,6-tetrone.
| Compound Name | (5S,6'R)-1-[(2-chlorophenyl)methyl]-7'-ethyl-6'-methylspiro[1,3-diazinane-5,5'-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene]-2,2',4,6-tetrone |
|---|---|
| PubChem CID | 92527759 |
| Molecular Formula | C24H22ClN5O4 |
| Molecular Weight | 479.92 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | (5S,6'R)-1-[(2-chlorophenyl)methyl]-7'-ethyl-6'-methylspiro[1,3-diazinane-5,5'-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene]-2,2',4,6-tetrone |
| SMILES | CCN1c2nc3ccccn3c(=O)c2C[C@@]2(C(=O)NC(=O)N(Cc3ccccc3Cl)C2=O)[C@H]1C |
| InChI | InChI=1S/C24H22ClN5O4/c1-3-28-14(2)24(12-16-19(28)26-18-10-6-7-11-29(18)20(16)31)21(32)27-23(34)30(22(24)33)13-15-8-4-5-9-17(15)25/h4-11,14H,3,12-13H2,1-2H3,(H,27,32,34)/t14-,24+/m1/s1 |
| InChIKey | JPBXXTVOAJVXEF-SHACYNPGSA-N |
| XLogP | 2.38 |
| TPSA | 104.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.92 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|