C23H34N2O2 — CID 98305706
(1R,3S,5R,7R)-3-ethyl-5-hydroxy-N-[3-(N-methylanilino)propyl]adamantane-1-carboxamide (PubChem CID 98305706) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is (1R,3S,5R,7R)-3-ethyl-5-hydroxy-N-[3-(N-methylanilino)propyl]adamantane-1-carboxamide.
| Compound Name | (1R,3S,5R,7R)-3-ethyl-5-hydroxy-N-[3-(N-methylanilino)propyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98305706 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | (1R,3S,5R,7R)-3-ethyl-5-hydroxy-N-[3-(N-methylanilino)propyl]adamantane-1-carboxamide |
| SMILES | CC[C@@]12C[C@H]3C[C@@](O)(C1)C[C@@](C(=O)NCCCN(C)c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C23H34N2O2/c1-3-21-12-18-13-22(15-21,17-23(27,14-18)16-21)20(26)24-10-7-11-25(2)19-8-5-4-6-9-19/h4-6,8-9,18,27H,3,7,10-17H2,1-2H3,(H,24,26)/t18-,21+,22-,23-/m1/s1 |
| InChIKey | APIZZLGMESRMNP-YJSIEXFISA-N |
| XLogP | 3.74 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|