C23H32N2O3 — CID 9017860
[2-[3-(N-methylanilino)propylamino]-2-oxoethyl] adamantane-1-carboxylate (PubChem CID 9017860) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is [2-[3-(N-methylanilino)propylamino]-2-oxoethyl] adamantane-1-carboxylate.
| Compound Name | [2-[3-(N-methylanilino)propylamino]-2-oxoethyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 9017860 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | [2-[3-(N-methylanilino)propylamino]-2-oxoethyl] adamantane-1-carboxylate |
| SMILES | CN(CCCNC(=O)COC(=O)C12CC3CC(CC(C3)C1)C2)c1ccccc1 |
| InChI | InChI=1S/C23H32N2O3/c1-25(20-6-3-2-4-7-20)9-5-8-24-21(26)16-28-22(27)23-13-17-10-18(14-23)12-19(11-17)15-23/h2-4,6-7,17-19H,5,8-16H2,1H3,(H,24,26) |
| InChIKey | AYRIADHCOXVCIZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|