C25H31N7O3 — CID 98310693
(5S,7R)-N'-[(3R)-1-(2,3-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]-3-(5-methyltetrazol-2-yl)adamantane-1-carbohydrazide (PubChem CID 98310693) has the molecular formula C25H31N7O3 and a molecular weight of 477.57 g/mol. Its IUPAC name is (5S,7R)-N'-[(3R)-1-(2,3-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]-3-(5-methyltetrazol-2-yl)adamantane-1-carbohydrazide.
| Compound Name | (5S,7R)-N'-[(3R)-1-(2,3-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]-3-(5-methyltetrazol-2-yl)adamantane-1-carbohydrazide |
|---|---|
| PubChem CID | 98310693 |
| Molecular Formula | C25H31N7O3 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | (5S,7R)-N'-[(3R)-1-(2,3-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]-3-(5-methyltetrazol-2-yl)adamantane-1-carbohydrazide |
| SMILES | Cc1nnn(C23C[C@@H]4C[C@@H](CC(C(=O)NN[C@@H]5CC(=O)N(c6cccc(C)c6C)C5=O)(C4)C2)C3)n1 |
| InChI | InChI=1S/C25H31N7O3/c1-14-5-4-6-20(15(14)2)31-21(33)8-19(22(31)34)27-28-23(35)24-9-17-7-18(10-24)12-25(11-17,13-24)32-29-16(3)26-30-32/h4-6,17-19,27H,7-13H2,1-3H3,(H,28,35)/t17-,18+,19-,24?,25?/m1/s1 |
| InChIKey | BCMSYQAJNURIKK-PCKLHMSXSA-N |
| XLogP | 1.85 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|