C21H30N6O — CID 98313560
1-(4-aminocyclohexyl)-N-[[(3S)-1-(4-methylphenyl)pyrrolidin-3-yl]methyl]triazole-4-carboxamide (PubChem CID 98313560) has the molecular formula C21H30N6O and a molecular weight of 382.51 g/mol. Its IUPAC name is 1-(4-aminocyclohexyl)-N-[[(3S)-1-(4-methylphenyl)pyrrolidin-3-yl]methyl]triazole-4-carboxamide.
| Compound Name | 1-(4-aminocyclohexyl)-N-[[(3S)-1-(4-methylphenyl)pyrrolidin-3-yl]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 98313560 |
| Molecular Formula | C21H30N6O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 1-(4-aminocyclohexyl)-N-[[(3S)-1-(4-methylphenyl)pyrrolidin-3-yl]methyl]triazole-4-carboxamide |
| SMILES | Cc1ccc(N2CC[C@@H](CNC(=O)c3cn(C4CCC(N)CC4)nn3)C2)cc1 |
| InChI | InChI=1S/C21H30N6O/c1-15-2-6-18(7-3-15)26-11-10-16(13-26)12-23-21(28)20-14-27(25-24-20)19-8-4-17(22)5-9-19/h2-3,6-7,14,16-17,19H,4-5,8-13,22H2,1H3,(H,23,28)/t16-,17?,19?/m0/s1 |
| InChIKey | QZJHCXZYCHMUSI-MUYFXNHWSA-N |
| XLogP | 2.29 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|