C22H26N4O4 — CID 98318567
(4R)-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-ethyl-11-methyl-10-oxa-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-12-carboxamide (PubChem CID 98318567) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is (4R)-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-ethyl-11-methyl-10-oxa-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-12-carboxamide.
| Compound Name | (4R)-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-ethyl-11-methyl-10-oxa-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-12-carboxamide |
|---|---|
| PubChem CID | 98318567 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | (4R)-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-ethyl-11-methyl-10-oxa-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-12-carboxamide |
| SMILES | CC[C@@H]1CN2C=Nc3oc(C)c(C(=O)NCCc4ccc(OC)c(OC)c4)c3C2=N1 |
| InChI | InChI=1S/C22H26N4O4/c1-5-15-11-26-12-24-22-19(20(26)25-15)18(13(2)30-22)21(27)23-9-8-14-6-7-16(28-3)17(10-14)29-4/h6-7,10,12,15H,5,8-9,11H2,1-4H3,(H,23,27)/t15-/m1/s1 |
| InChIKey | SKRNLAPXOAWIPX-OAHLLOKOSA-N |
| XLogP | 3.09 |
| TPSA | 88.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |