C21H24N4O4 — CID 143746678
4-ethyl-N-[2-(3-hydroxy-4-methoxyphenyl)ethyl]-11-methyl-10-oxa-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-12-carboxamide (PubChem CID 143746678) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is 4-ethyl-N-[2-(3-hydroxy-4-methoxyphenyl)ethyl]-11-methyl-10-oxa-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-12-carboxamide.
| Compound Name | 4-ethyl-N-[2-(3-hydroxy-4-methoxyphenyl)ethyl]-11-methyl-10-oxa-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-12-carboxamide |
|---|---|
| PubChem CID | 143746678 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 4-ethyl-N-[2-(3-hydroxy-4-methoxyphenyl)ethyl]-11-methyl-10-oxa-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-12-carboxamide |
| SMILES | CCC1CN2C=Nc3oc(C)c(C(=O)NCCc4ccc(OC)c(O)c4)c3C2=N1 |
| InChI | InChI=1S/C21H24N4O4/c1-4-14-10-25-11-23-21-18(19(25)24-14)17(12(2)29-21)20(27)22-8-7-13-5-6-16(28-3)15(26)9-13/h5-6,9,11,14,26H,4,7-8,10H2,1-3H3,(H,22,27) |
| InChIKey | NIRXAFLWIQRWEF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |