C25H21F3N2O4 — CID 98320334
N-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]methyl]-3-methoxy-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 98320334) has the molecular formula C25H21F3N2O4 and a molecular weight of 470.45 g/mol. Its IUPAC name is N-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]methyl]-3-methoxy-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]methyl]-3-methoxy-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 98320334 |
| Molecular Formula | C25H21F3N2O4 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | N-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]methyl]-3-methoxy-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | COc1cccc(C(=O)N(CN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C25H21F3N2O4/c1-34-19-7-2-4-16(11-19)22(31)29(18-6-3-5-17(12-18)25(26,27)28)13-30-23(32)20-14-8-9-15(10-14)21(20)24(30)33/h2-9,11-12,14-15,20-21H,10,13H2,1H3/t14-,15-,20-,21+/m0/s1 |
| InChIKey | ULLLQKAXELGNSP-LATRNWQMSA-N |
| XLogP | 4.13 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|