C17H17Cl2NO3S — CID 98328936
N-[(1S)-2,2-dichloro-1-(4-methylphenyl)sulfonylethyl]-4-methylbenzamide (PubChem CID 98328936) has the molecular formula C17H17Cl2NO3S and a molecular weight of 386.30 g/mol. Its IUPAC name is N-[(1S)-2,2-dichloro-1-(4-methylphenyl)sulfonylethyl]-4-methylbenzamide.
| Compound Name | N-[(1S)-2,2-dichloro-1-(4-methylphenyl)sulfonylethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 98328936 |
| Molecular Formula | C17H17Cl2NO3S |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | N-[(1S)-2,2-dichloro-1-(4-methylphenyl)sulfonylethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N[C@H](C(Cl)Cl)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C17H17Cl2NO3S/c1-11-3-7-13(8-4-11)16(21)20-17(15(18)19)24(22,23)14-9-5-12(2)6-10-14/h3-10,15,17H,1-2H3,(H,20,21)/t17-/m0/s1 |
| InChIKey | JKDISBSBSWWQGO-KRWDZBQOSA-N |
| XLogP | 3.64 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|