C20H15Br2NO4S — CID 98339403
[4-[(1R,2S,6S,7R,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] thiophene-2-carboxylate (PubChem CID 98339403) has the molecular formula C20H15Br2NO4S and a molecular weight of 525.22 g/mol. Its IUPAC name is [4-[(1R,2S,6S,7R,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] thiophene-2-carboxylate.
| Compound Name | [4-[(1R,2S,6S,7R,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 98339403 |
| Molecular Formula | C20H15Br2NO4S |
| Molecular Weight | 525.22 g/mol |
| Exact Mass | 522.91 |
| IUPAC Name | [4-[(1R,2S,6S,7R,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] thiophene-2-carboxylate |
| SMILES | O=C(Oc1ccc(N2C(=O)[C@@H]3[C@H]4C[C@@H]([C@@H](Br)[C@H]4Br)[C@H]3C2=O)cc1)c1cccs1 |
| InChI | InChI=1S/C20H15Br2NO4S/c21-16-11-8-12(17(16)22)15-14(11)18(24)23(19(15)25)9-3-5-10(6-4-9)27-20(26)13-2-1-7-28-13/h1-7,11-12,14-17H,8H2/t11-,12-,14-,15-,16-,17+/m1/s1 |
| InChIKey | VQZRLGNMYZHDBJ-RZRDZNJRSA-N |
| XLogP | 4.25 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.22 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|