C22H21F3N4O2 — CID 98342656
(3R)-3-[[4-(4-methylpiperidine-1-carbonyl)phenyl]diazenyl]-7-(trifluoromethyl)-1,3-dihydroindol-2-one (PubChem CID 98342656) has the molecular formula C22H21F3N4O2 and a molecular weight of 430.43 g/mol. Its IUPAC name is (3R)-3-[[4-(4-methylpiperidine-1-carbonyl)phenyl]diazenyl]-7-(trifluoromethyl)-1,3-dihydroindol-2-one.
| Compound Name | (3R)-3-[[4-(4-methylpiperidine-1-carbonyl)phenyl]diazenyl]-7-(trifluoromethyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 98342656 |
| Molecular Formula | C22H21F3N4O2 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | (3R)-3-[[4-(4-methylpiperidine-1-carbonyl)phenyl]diazenyl]-7-(trifluoromethyl)-1,3-dihydroindol-2-one |
| SMILES | CC1CCN(C(=O)c2ccc(/N=N/[C@H]3C(=O)Nc4c3cccc4C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H21F3N4O2/c1-13-9-11-29(12-10-13)21(31)14-5-7-15(8-6-14)27-28-19-16-3-2-4-17(22(23,24)25)18(16)26-20(19)30/h2-8,13,19H,9-12H2,1H3,(H,26,30)/b28-27+/t19-/m1/s1 |
| InChIKey | REOLJOINEXVZNC-YMRWSMOXSA-N |
| XLogP | 5.35 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|