C19H17N3O6S — CID 98345256
[(4S)-2-(4-methylphenyl)sulfonyl-4-(3-nitrophenyl)-3,4-dihydropyrazol-5-yl]-[(2R)-oxiran-2-yl]methanone (PubChem CID 98345256) has the molecular formula C19H17N3O6S and a molecular weight of 415.43 g/mol. Its IUPAC name is [(4S)-2-(4-methylphenyl)sulfonyl-4-(3-nitrophenyl)-3,4-dihydropyrazol-5-yl]-[(2R)-oxiran-2-yl]methanone.
| Compound Name | [(4S)-2-(4-methylphenyl)sulfonyl-4-(3-nitrophenyl)-3,4-dihydropyrazol-5-yl]-[(2R)-oxiran-2-yl]methanone |
|---|---|
| PubChem CID | 98345256 |
| Molecular Formula | C19H17N3O6S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | [(4S)-2-(4-methylphenyl)sulfonyl-4-(3-nitrophenyl)-3,4-dihydropyrazol-5-yl]-[(2R)-oxiran-2-yl]methanone |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H](c3cccc([N+](=O)[O-])c3)C(C(=O)[C@H]3CO3)=N2)cc1 |
| InChI | InChI=1S/C19H17N3O6S/c1-12-5-7-15(8-6-12)29(26,27)21-10-16(18(20-21)19(23)17-11-28-17)13-3-2-4-14(9-13)22(24)25/h2-9,16-17H,10-11H2,1H3/t16-,17-/m1/s1 |
| InChIKey | KLKDJCSOJQMCRI-IAGOWNOFSA-N |
| XLogP | 2.02 |
| TPSA | 122.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|