C19H15FN4O2 — CID 98346990
(1R,6R,8R,9R)-9-(3-fluorophenyl)-12-imino-10,11-dioxatricyclo[6.2.2.01,6]dodecane-7,7,8-tricarbonitrile (PubChem CID 98346990) has the molecular formula C19H15FN4O2 and a molecular weight of 350.35 g/mol. Its IUPAC name is (1R,6R,8R,9R)-9-(3-fluorophenyl)-12-imino-10,11-dioxatricyclo[6.2.2.01,6]dodecane-7,7,8-tricarbonitrile.
| Compound Name | (1R,6R,8R,9R)-9-(3-fluorophenyl)-12-imino-10,11-dioxatricyclo[6.2.2.01,6]dodecane-7,7,8-tricarbonitrile |
|---|---|
| PubChem CID | 98346990 |
| Molecular Formula | C19H15FN4O2 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | (1R,6R,8R,9R)-9-(3-fluorophenyl)-12-imino-10,11-dioxatricyclo[6.2.2.01,6]dodecane-7,7,8-tricarbonitrile |
| SMILES | [H]/N=C1\O[C@]23CCCC[C@@H]2C(C#N)(C#N)[C@@]1(C#N)[C@@H](c1cccc(F)c1)O3 |
| InChI | InChI=1S/C19H15FN4O2/c20-13-5-3-4-12(8-13)15-18(11-23)16(24)26-19(25-15)7-2-1-6-14(19)17(18,9-21)10-22/h3-5,8,14-15,24H,1-2,6-7H2/b24-16-/t14-,15-,18+,19-/m1/s1 |
| InChIKey | QOXYKXOQFVXHFB-LGXIFHKWSA-N |
| XLogP | 3.33 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|