C16H11BrN2O5S2 — CID 98358907
methyl (1R,8R,9R)-11-(4-bromophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-8-carboxylate (PubChem CID 98358907) has the molecular formula C16H11BrN2O5S2 and a molecular weight of 455.31 g/mol. Its IUPAC name is methyl (1R,8R,9R)-11-(4-bromophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-8-carboxylate.
| Compound Name | methyl (1R,8R,9R)-11-(4-bromophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-8-carboxylate |
|---|---|
| PubChem CID | 98358907 |
| Molecular Formula | C16H11BrN2O5S2 |
| Molecular Weight | 455.31 g/mol |
| Exact Mass | 453.93 |
| IUPAC Name | methyl (1R,8R,9R)-11-(4-bromophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-8-carboxylate |
| SMILES | COC(=O)[C@@H]1c2sc(=O)[nH]c2S[C@H]2C(=O)N(c3ccc(Br)cc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C16H11BrN2O5S2/c1-24-15(22)9-8-11(25-12-10(9)26-16(23)18-12)14(21)19(13(8)20)7-4-2-6(17)3-5-7/h2-5,8-9,11H,1H3,(H,18,23)/t8-,9-,11+/m0/s1 |
| InChIKey | IVWIRFXXLFTTTL-ATZCPNFKSA-N |
| XLogP | 2.12 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|