C29H30N6S — CID 98367249
(1R,9S)-5,11-dibenzyl-8-sulfanylidenespiro[3,5,7,11-tetrazatricyclo[7.3.1.02,7]tridec-2-ene-13,1'-cyclopentane]-1,9-dicarbonitrile (PubChem CID 98367249) has the molecular formula C29H30N6S and a molecular weight of 494.67 g/mol. Its IUPAC name is (1R,9S)-5,11-dibenzyl-8-sulfanylidenespiro[3,5,7,11-tetrazatricyclo[7.3.1.02,7]tridec-2-ene-13,1'-cyclopentane]-1,9-dicarbonitrile.
| Compound Name | (1R,9S)-5,11-dibenzyl-8-sulfanylidenespiro[3,5,7,11-tetrazatricyclo[7.3.1.02,7]tridec-2-ene-13,1'-cyclopentane]-1,9-dicarbonitrile |
|---|---|
| PubChem CID | 98367249 |
| Molecular Formula | C29H30N6S |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | (1R,9S)-5,11-dibenzyl-8-sulfanylidenespiro[3,5,7,11-tetrazatricyclo[7.3.1.02,7]tridec-2-ene-13,1'-cyclopentane]-1,9-dicarbonitrile |
| SMILES | N#C[C@]12CN(Cc3ccccc3)C[C@](C#N)(C3=NCN(Cc4ccccc4)CN3C1=S)C21CCCC1 |
| InChI | InChI=1S/C29H30N6S/c30-17-27-19-33(15-23-9-3-1-4-10-23)20-28(18-31,29(27)13-7-8-14-29)26(36)35-22-34(21-32-25(27)35)16-24-11-5-2-6-12-24/h1-6,9-12H,7-8,13-16,19-22H2/t27-,28+/m1/s1 |
| InChIKey | UFGXRWBKTHTQPU-IZLXSDGUSA-N |
| XLogP | 4.55 |
| TPSA | 69.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|