C36H37N7Se — CID 45032080
1'-benzyl-5,11-bis(4-methylphenyl)-8-selanylidenespiro[3,5,7,11-tetrazatricyclo[7.3.1.02,7]tridec-2-ene-13,4'-piperidine]-1,9-dicarbonitrile (PubChem CID 45032080) has the molecular formula C36H37N7Se and a molecular weight of 646.70 g/mol. Its IUPAC name is 1'-benzyl-5,11-bis(4-methylphenyl)-8-selanylidenespiro[3,5,7,11-tetrazatricyclo[7.3.1.02,7]tridec-2-ene-13,4'-piperidine]-1,9-dicarbonitrile.
| Compound Name | 1'-benzyl-5,11-bis(4-methylphenyl)-8-selanylidenespiro[3,5,7,11-tetrazatricyclo[7.3.1.02,7]tridec-2-ene-13,4'-piperidine]-1,9-dicarbonitrile |
|---|---|
| PubChem CID | 45032080 |
| Molecular Formula | C36H37N7Se |
| Molecular Weight | 646.70 g/mol |
| Exact Mass | 647.23 |
| IUPAC Name | 1'-benzyl-5,11-bis(4-methylphenyl)-8-selanylidenespiro[3,5,7,11-tetrazatricyclo[7.3.1.02,7]tridec-2-ene-13,4'-piperidine]-1,9-dicarbonitrile |
| SMILES | Cc1ccc(N2CN=C3N(C2)C(=[Se])C2(C#N)CN(c4ccc(C)cc4)CC3(C#N)C23CCN(Cc2ccccc2)CC3)cc1 |
| InChI | InChI=1S/C36H37N7Se/c1-27-8-12-30(13-9-27)41-23-34(21-37)32-39-25-42(31-14-10-28(2)11-15-31)26-43(32)33(44)35(22-38,24-41)36(34)16-18-40(19-17-36)20-29-6-4-3-5-7-29/h3-15H,16-20,23-26H2,1-2H3 |
| InChIKey | YZMKGQTZNJJEBN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 72.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.70 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|