C20H24N2O4 — CID 98374786
2-[(5R,7R)-3-hydroxy-1-adamantyl]-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone (PubChem CID 98374786) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 2-[(5R,7R)-3-hydroxy-1-adamantyl]-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 2-[(5R,7R)-3-hydroxy-1-adamantyl]-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 98374786 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-[(5R,7R)-3-hydroxy-1-adamantyl]-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone |
| SMILES | O=C(CC12C[C@H]3C[C@@H](CC(O)(C3)C1)C2)N1CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C20H24N2O4/c23-18(21-4-3-15-1-2-16(22(25)26)6-17(15)21)11-19-7-13-5-14(8-19)10-20(24,9-13)12-19/h1-2,6,13-14,24H,3-5,7-12H2/t13-,14-,19?,20?/m1/s1 |
| InChIKey | OABVPJFGWUWUQK-RCRDTURJSA-N |
| XLogP | 3.21 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|