C28H23Cl3N2O5S — CID 98374850
ethyl 2-[(3R,3aS,6aR)-2-(4-chlorophenyl)-3-(2,4-dichlorophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 98374850) has the molecular formula C28H23Cl3N2O5S and a molecular weight of 605.93 g/mol. Its IUPAC name is ethyl 2-[(3R,3aS,6aR)-2-(4-chlorophenyl)-3-(2,4-dichlorophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[(3R,3aS,6aR)-2-(4-chlorophenyl)-3-(2,4-dichlorophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 98374850 |
| Molecular Formula | C28H23Cl3N2O5S |
| Molecular Weight | 605.93 g/mol |
| Exact Mass | 604.04 |
| IUPAC Name | ethyl 2-[(3R,3aS,6aR)-2-(4-chlorophenyl)-3-(2,4-dichlorophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N2C(=O)[C@@H]3[C@@H](ON(c4ccc(Cl)cc4)[C@H]3c3ccc(Cl)cc3Cl)C2=O)sc2c1CCCC2 |
| InChI | InChI=1S/C28H23Cl3N2O5S/c1-2-37-28(36)21-18-5-3-4-6-20(18)39-27(21)32-25(34)22-23(17-12-9-15(30)13-19(17)31)33(38-24(22)26(32)35)16-10-7-14(29)8-11-16/h7-13,22-24H,2-6H2,1H3/t22-,23-,24+/m0/s1 |
| InChIKey | IWFOOAMFMMDWIE-KMDXXIMOSA-N |
| XLogP | 6.81 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.93 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|