C26H22Cl2N2O5S — CID 98171736
methyl 2-[(3R,3aR,6aR)-3-(2,4-dichlorophenyl)-2-(2-methylphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 98171736) has the molecular formula C26H22Cl2N2O5S and a molecular weight of 545.44 g/mol. Its IUPAC name is methyl 2-[(3R,3aR,6aR)-3-(2,4-dichlorophenyl)-2-(2-methylphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(3R,3aR,6aR)-3-(2,4-dichlorophenyl)-2-(2-methylphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 98171736 |
| Molecular Formula | C26H22Cl2N2O5S |
| Molecular Weight | 545.44 g/mol |
| Exact Mass | 544.06 |
| IUPAC Name | methyl 2-[(3R,3aR,6aR)-3-(2,4-dichlorophenyl)-2-(2-methylphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(N2C(=O)[C@H]3[C@@H](ON(c4ccccc4C)[C@H]3c3ccc(Cl)cc3Cl)C2=O)sc(C)c1C |
| InChI | InChI=1S/C26H22Cl2N2O5S/c1-12-7-5-6-8-18(12)30-21(16-10-9-15(27)11-17(16)28)20-22(35-30)24(32)29(23(20)31)25-19(26(33)34-4)13(2)14(3)36-25/h5-11,20-22H,1-4H3/t20-,21+,22-/m1/s1 |
| InChIKey | RGMSCIUEXKEGHY-BHIFYINESA-N |
| XLogP | 5.82 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.44 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|