C31H27N3O7S2 — CID 98375210
(4E,5S)-5-(4-tert-butylphenyl)-4-[hydroxy-(4-methylphenyl)methylidene]-1-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]pyrrolidine-2,3-dione (PubChem CID 98375210) has the molecular formula C31H27N3O7S2 and a molecular weight of 617.71 g/mol. Its IUPAC name is (4E,5S)-5-(4-tert-butylphenyl)-4-[hydroxy-(4-methylphenyl)methylidene]-1-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-5-(4-tert-butylphenyl)-4-[hydroxy-(4-methylphenyl)methylidene]-1-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98375210 |
| Molecular Formula | C31H27N3O7S2 |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.13 |
| IUPAC Name | (4E,5S)-5-(4-tert-butylphenyl)-4-[hydroxy-(4-methylphenyl)methylidene]-1-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(/C(O)=C2\C(=O)C(=O)N(c3ncc(S(=O)(=O)c4ccc([N+](=O)[O-])cc4)s3)[C@H]2c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C31H27N3O7S2/c1-18-5-7-20(8-6-18)27(35)25-26(19-9-11-21(12-10-19)31(2,3)4)33(29(37)28(25)36)30-32-17-24(42-30)43(40,41)23-15-13-22(14-16-23)34(38)39/h5-17,26,35H,1-4H3/b27-25+/t26-/m0/s1 |
| InChIKey | QZMXZKSYYRESPX-CZNAVJSXSA-N |
| XLogP | 6.12 |
| TPSA | 147.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|