C29H23N5O6 — CID 98382502
(1S,3S,3aR,6aS)-1-(1H-indol-3-ylmethyl)-5-(2-methoxy-5-nitrophenyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 98382502) has the molecular formula C29H23N5O6 and a molecular weight of 537.53 g/mol. Its IUPAC name is (1S,3S,3aR,6aS)-1-(1H-indol-3-ylmethyl)-5-(2-methoxy-5-nitrophenyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1S,3S,3aR,6aS)-1-(1H-indol-3-ylmethyl)-5-(2-methoxy-5-nitrophenyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 98382502 |
| Molecular Formula | C29H23N5O6 |
| Molecular Weight | 537.53 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | (1S,3S,3aR,6aS)-1-(1H-indol-3-ylmethyl)-5-(2-methoxy-5-nitrophenyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | COc1ccc([N+](=O)[O-])cc1N1C(=O)[C@@H]2[C@H](Cc3c[nH]c4ccccc34)N[C@@]3(C(=O)Nc4ccccc43)[C@@H]2C1=O |
| InChI | InChI=1S/C29H23N5O6/c1-40-23-11-10-16(34(38)39)13-22(23)33-26(35)24-21(12-15-14-30-19-8-4-2-6-17(15)19)32-29(25(24)27(33)36)18-7-3-5-9-20(18)31-28(29)37/h2-11,13-14,21,24-25,30,32H,12H2,1H3,(H,31,37)/t21-,24+,25-,29+/m0/s1 |
| InChIKey | WQMCHSNDTJUYGO-CVRJGYJLSA-N |
| XLogP | 3.25 |
| TPSA | 146.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|