C23H22N4O6S — CID 6588873
(1S,3S,3aR,6aR)-5-(2-methoxy-5-nitrophenyl)-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 6588873) has the molecular formula C23H22N4O6S and a molecular weight of 482.52 g/mol. Its IUPAC name is (1S,3S,3aR,6aR)-5-(2-methoxy-5-nitrophenyl)-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1S,3S,3aR,6aR)-5-(2-methoxy-5-nitrophenyl)-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 6588873 |
| Molecular Formula | C23H22N4O6S |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | (1S,3S,3aR,6aR)-5-(2-methoxy-5-nitrophenyl)-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | COc1ccc([N+](=O)[O-])cc1N1C(=O)[C@H]2[C@H](CCSC)N[C@@]3(C(=O)Nc4ccccc43)[C@@H]2C1=O |
| InChI | InChI=1S/C23H22N4O6S/c1-33-17-8-7-12(27(31)32)11-16(17)26-20(28)18-15(9-10-34-2)25-23(19(18)21(26)29)13-5-3-4-6-14(13)24-22(23)30/h3-8,11,15,18-19,25H,9-10H2,1-2H3,(H,24,30)/t15-,18-,19-,23+/m0/s1 |
| InChIKey | SVAYYPFVOXXCKI-HTIQSUCMSA-N |
| XLogP | 2.28 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|