C24H24N4O6S — CID 51705277
(1R,3S,3aR,6aR)-5-(5-methoxy-2-methyl-4-nitrophenyl)-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 51705277) has the molecular formula C24H24N4O6S and a molecular weight of 496.55 g/mol. Its IUPAC name is (1R,3S,3aR,6aR)-5-(5-methoxy-2-methyl-4-nitrophenyl)-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1R,3S,3aR,6aR)-5-(5-methoxy-2-methyl-4-nitrophenyl)-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 51705277 |
| Molecular Formula | C24H24N4O6S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | (1R,3S,3aR,6aR)-5-(5-methoxy-2-methyl-4-nitrophenyl)-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | COc1cc(N2C(=O)[C@@H]3[C@@H](C2=O)[C@@]2(N[C@@H]3CCSC)C(=O)Nc3ccccc32)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H24N4O6S/c1-12-10-17(28(32)33)18(34-2)11-16(12)27-21(29)19-15(8-9-35-3)26-24(20(19)22(27)30)13-6-4-5-7-14(13)25-23(24)31/h4-7,10-11,15,19-20,26H,8-9H2,1-3H3,(H,25,31)/t15-,19+,20+,24-/m1/s1 |
| InChIKey | FFBWWZVOBWOVDP-BBOHXYNISA-N |
| XLogP | 2.59 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|